C15H13N3O3 — CID 154810740
(E)-2-cyano-N-(2,6-dioxopiperidin-3-yl)-3-phenylprop-2-enamide (PubChem CID 154810740) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,6-dioxopiperidin-3-yl)-3-phenylprop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,6-dioxopiperidin-3-yl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 154810740 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (E)-2-cyano-N-(2,6-dioxopiperidin-3-yl)-3-phenylprop-2-enamide |
| SMILES | N#C/C(=C\c1ccccc1)C(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C15H13N3O3/c16-9-11(8-10-4-2-1-3-5-10)14(20)17-12-6-7-13(19)18-15(12)21/h1-5,8,12H,6-7H2,(H,17,20)(H,18,19,21)/b11-8+ |
| InChIKey | XVMNZKSXKSVGGX-DHZHZOJOSA-N |
| XLogP | 0.51 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|