C17H20N4O3 — CID 138466889
(E)-3-[benzyl-(methylideneamino)amino]-N-(2,6-dioxopiperidin-3-yl)-2-methylprop-2-enamide (PubChem CID 138466889) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is (E)-3-[benzyl-(methylideneamino)amino]-N-(2,6-dioxopiperidin-3-yl)-2-methylprop-2-enamide.
| Compound Name | (E)-3-[benzyl-(methylideneamino)amino]-N-(2,6-dioxopiperidin-3-yl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 138466889 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (E)-3-[benzyl-(methylideneamino)amino]-N-(2,6-dioxopiperidin-3-yl)-2-methylprop-2-enamide |
| SMILES | C=NN(/C=C(\C)C(=O)NC1CCC(=O)NC1=O)Cc1ccccc1 |
| InChI | InChI=1S/C17H20N4O3/c1-12(10-21(18-2)11-13-6-4-3-5-7-13)16(23)19-14-8-9-15(22)20-17(14)24/h3-7,10,14H,2,8-9,11H2,1H3,(H,19,23)(H,20,22,24)/b12-10+ |
| InChIKey | XWFAZBPTMRUPNW-ZRDIBKRKSA-N |
| XLogP | 0.93 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|