C20H26N2O6 — CID 134581665
(E)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-3-(2-phenylmethoxyethylperoxy)but-2-enamide (PubChem CID 134581665) has the molecular formula C20H26N2O6 and a molecular weight of 390.44 g/mol. Its IUPAC name is (E)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-3-(2-phenylmethoxyethylperoxy)but-2-enamide.
| Compound Name | (E)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-3-(2-phenylmethoxyethylperoxy)but-2-enamide |
|---|---|
| PubChem CID | 134581665 |
| Molecular Formula | C20H26N2O6 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (E)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-3-(2-phenylmethoxyethylperoxy)but-2-enamide |
| SMILES | CC/C(C(=O)NC1CCC(=O)NC1=O)=C(/C)OOCCOCc1ccccc1 |
| InChI | InChI=1S/C20H26N2O6/c1-3-16(19(24)21-17-9-10-18(23)22-20(17)25)14(2)28-27-12-11-26-13-15-7-5-4-6-8-15/h4-8,17H,3,9-13H2,1-2H3,(H,21,24)(H,22,23,25)/b16-14+ |
| InChIKey | FVFNONINFLPKIE-JQIJEIRASA-N |
| XLogP | 1.76 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|