C25H28N2O6 — CID 171529657
8-[[(2,6-dioxopiperidin-3-yl)amino]methyl]-3-(2-phenylmethoxyethyl)-3,4-dihydro-2H-chromene-7-carboxylic acid (PubChem CID 171529657) has the molecular formula C25H28N2O6 and a molecular weight of 452.51 g/mol. Its IUPAC name is 8-[[(2,6-dioxopiperidin-3-yl)amino]methyl]-3-(2-phenylmethoxyethyl)-3,4-dihydro-2H-chromene-7-carboxylic acid.
| Compound Name | 8-[[(2,6-dioxopiperidin-3-yl)amino]methyl]-3-(2-phenylmethoxyethyl)-3,4-dihydro-2H-chromene-7-carboxylic acid |
|---|---|
| PubChem CID | 171529657 |
| Molecular Formula | C25H28N2O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 8-[[(2,6-dioxopiperidin-3-yl)amino]methyl]-3-(2-phenylmethoxyethyl)-3,4-dihydro-2H-chromene-7-carboxylic acid |
| SMILES | O=C1CCC(NCc2c(C(=O)O)ccc3c2OCC(CCOCc2ccccc2)C3)C(=O)N1 |
| InChI | InChI=1S/C25H28N2O6/c28-22-9-8-21(24(29)27-22)26-13-20-19(25(30)31)7-6-18-12-17(15-33-23(18)20)10-11-32-14-16-4-2-1-3-5-16/h1-7,17,21,26H,8-15H2,(H,30,31)(H,27,28,29) |
| InChIKey | FTOJVRSSUHECCW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|