C25H39N3O9 — CID 131999638
2-[[(2,6-dioxopiperidin-3-yl)amino]methyl]-3-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]benzaldehyde (PubChem CID 131999638) has the molecular formula C25H39N3O9 and a molecular weight of 525.60 g/mol. Its IUPAC name is 2-[[(2,6-dioxopiperidin-3-yl)amino]methyl]-3-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]benzaldehyde.
| Compound Name | 2-[[(2,6-dioxopiperidin-3-yl)amino]methyl]-3-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]benzaldehyde |
|---|---|
| PubChem CID | 131999638 |
| Molecular Formula | C25H39N3O9 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | 2-[[(2,6-dioxopiperidin-3-yl)amino]methyl]-3-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]benzaldehyde |
| SMILES | O=Cc1cccc(NCCOCCOCCOCCOCCOCCO)c1CNC1CCC(=O)NC1=O |
| InChI | InChI=1S/C25H39N3O9/c29-7-9-34-11-13-36-15-17-37-16-14-35-12-10-33-8-6-26-22-3-1-2-20(19-30)21(22)18-27-23-4-5-24(31)28-25(23)32/h1-3,19,23,26-27,29H,4-18H2,(H,28,31,32) |
| InChIKey | DQUXURQOGHXBRE-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 153.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|