C14H16N2O4 — CID 139483413
2-[[(2,6-dioxopiperidin-3-yl)amino]methyl]-6-methoxybenzaldehyde (PubChem CID 139483413) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-[[(2,6-dioxopiperidin-3-yl)amino]methyl]-6-methoxybenzaldehyde.
| Compound Name | 2-[[(2,6-dioxopiperidin-3-yl)amino]methyl]-6-methoxybenzaldehyde |
|---|---|
| PubChem CID | 139483413 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-[[(2,6-dioxopiperidin-3-yl)amino]methyl]-6-methoxybenzaldehyde |
| SMILES | COc1cccc(CNC2CCC(=O)NC2=O)c1C=O |
| InChI | InChI=1S/C14H16N2O4/c1-20-12-4-2-3-9(10(12)8-17)7-15-11-5-6-13(18)16-14(11)19/h2-4,8,11,15H,5-7H2,1H3,(H,16,18,19) |
| InChIKey | PLYHVYVHNRXMPU-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|