C15H17N3O5 — CID 163559845
2-[3-[[(2,6-dioxopiperidin-3-yl)amino]methyl]-4-formylanilino]acetic acid (PubChem CID 163559845) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 2-[3-[[(2,6-dioxopiperidin-3-yl)amino]methyl]-4-formylanilino]acetic acid.
| Compound Name | 2-[3-[[(2,6-dioxopiperidin-3-yl)amino]methyl]-4-formylanilino]acetic acid |
|---|---|
| PubChem CID | 163559845 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-[3-[[(2,6-dioxopiperidin-3-yl)amino]methyl]-4-formylanilino]acetic acid |
| SMILES | O=Cc1ccc(NCC(=O)O)cc1CNC1CCC(=O)NC1=O |
| InChI | InChI=1S/C15H17N3O5/c19-8-9-1-2-11(16-7-14(21)22)5-10(9)6-17-12-3-4-13(20)18-15(12)23/h1-2,5,8,12,16-17H,3-4,6-7H2,(H,21,22)(H,18,20,23) |
| InChIKey | FQHKHLLHJRAFDT-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|