About 2-[[[(3R)-2,6-dioxopiperidin-3-yl]amino]methyl]benzoic acid;hydrobromide
2-[[[(3R)-2,6-dioxopiperidin-3-yl]amino]methyl]benzoic acid;hydrobromide (PubChem CID 162326588) has the molecular formula C13H15BrN2O4
and a molecular weight of 343.18 g/mol. Its IUPAC name is 2-[[[(3R)-2,6-dioxopiperidin-3-yl]amino]methyl]benzoic acid;hydrobromide.
Molecular Properties
| Compound Name | 2-[[[(3R)-2,6-dioxopiperidin-3-yl]amino]methyl]benzoic acid;hydrobromide |
| PubChem CID | 162326588 |
| Molecular Formula | C13H15BrN2O4 |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 2-[[[(3R)-2,6-dioxopiperidin-3-yl]amino]methyl]benzoic acid;hydrobromide |
| SMILES | Br.O=C1CC[C@@H](NCc2ccccc2C(=O)O)C(=O)N1 |
| InChI | InChI=1S/C13H14N2O4.BrH/c16-11-6-5-10(12(17)15-11)14-7-8-3-1-2-4-9(8)13(18)19;/h1-4,10,14H,5-7H2,(H,18,19)(H,15,16,17);1H/t10-;/m1./s1 |
| InChIKey | RKBYHDZWRPYZKH-HNCPQSOCSA-N |
| XLogP | 0.86 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[[(3R)-2,6-dioxopiperidin-3-yl]amino]methyl]benzoic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[(3R)-2,6-dioxopiperidin-3-yl]amino]methyl]benzoic acid;hydrobromide?
The IUPAC name of 2-[[[(3R)-2,6-dioxopiperidin-3-yl]amino]methyl]benzoic acid;hydrobromide (CID 162326588) is 2-[[[(3R)-2,6-dioxopiperidin-3-yl]amino]methyl]benzoic acid;hydrobromide.
What is the SMILES notation for 2-[[[(3R)-2,6-dioxopiperidin-3-yl]amino]methyl]benzoic acid;hydrobromide?
The canonical SMILES for 2-[[[(3R)-2,6-dioxopiperidin-3-yl]amino]methyl]benzoic acid;hydrobromide is Br.O=C1CC[C@@H](NCc2ccccc2C(=O)O)C(=O)N1.
What is the InChIKey of 2-[[[(3R)-2,6-dioxopiperidin-3-yl]amino]methyl]benzoic acid;hydrobromide?
The InChIKey is RKBYHDZWRPYZKH-HNCPQSOCSA-N. The full InChI is InChI=1S/C13H14N2O4.BrH/c16-11-6-5-10(12(17)15-11)14-7-8-3-1-2-4-9(8)13(18)19;/h1-4,10,14H,5-7H2,(H,18,19)(H,15,16,17);1H/t10-;/m1./s1.
What are the key properties of 2-[[[(3R)-2,6-dioxopiperidin-3-yl]amino]methyl]benzoic acid;hydrobromide?
2-[[[(3R)-2,6-dioxopiperidin-3-yl]amino]methyl]benzoic acid;hydrobromide has a molecular weight of 343.18 g/mol, XLogP of 0.86, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[(3R)-2,6-dioxopiperidin-3-yl]amino]methyl]benzoic acid;hydrobromide is sourced from PubChem (CID 162326588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).