C30H33N3O6 — CID 102081252
2-[[[3,5-bis[(2-carboxyphenyl)methylamino]cyclohexyl]amino]methyl]benzoic acid (PubChem CID 102081252) has the molecular formula C30H33N3O6 and a molecular weight of 531.61 g/mol. Its IUPAC name is 2-[[[3,5-bis[(2-carboxyphenyl)methylamino]cyclohexyl]amino]methyl]benzoic acid.
| Compound Name | 2-[[[3,5-bis[(2-carboxyphenyl)methylamino]cyclohexyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 102081252 |
| Molecular Formula | C30H33N3O6 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | 2-[[[3,5-bis[(2-carboxyphenyl)methylamino]cyclohexyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CNC1CC(NCc2ccccc2C(=O)O)CC(NCc2ccccc2C(=O)O)C1 |
| InChI | InChI=1S/C30H33N3O6/c34-28(35)25-10-4-1-7-19(25)16-31-22-13-23(32-17-20-8-2-5-11-26(20)29(36)37)15-24(14-22)33-18-21-9-3-6-12-27(21)30(38)39/h1-12,22-24,31-33H,13-18H2,(H,34,35)(H,36,37)(H,38,39) |
| InChIKey | RMJQRMWHSQHJBV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 147.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |