C18H24N4O4 — CID 162486117
5-(5-aminopentylamino)-N-(2,6-dioxopiperidin-3-yl)-2-formylbenzamide (PubChem CID 162486117) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 5-(5-aminopentylamino)-N-(2,6-dioxopiperidin-3-yl)-2-formylbenzamide.
| Compound Name | 5-(5-aminopentylamino)-N-(2,6-dioxopiperidin-3-yl)-2-formylbenzamide |
|---|---|
| PubChem CID | 162486117 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 5-(5-aminopentylamino)-N-(2,6-dioxopiperidin-3-yl)-2-formylbenzamide |
| SMILES | NCCCCCNc1ccc(C=O)c(C(=O)NC2CCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C18H24N4O4/c19-8-2-1-3-9-20-13-5-4-12(11-23)14(10-13)17(25)21-15-6-7-16(24)22-18(15)26/h4-5,10-11,15,20H,1-3,6-9,19H2,(H,21,25)(H,22,24,26) |
| InChIKey | RAQZOGHDJZJEMG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|