C25H35N3O4 — CID 163374061
9-[3-formyl-4-[1-[methyl-(2-methylidene-6-oxopiperidin-3-yl)amino]ethenyl]anilino]nonanoic acid (PubChem CID 163374061) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is 9-[3-formyl-4-[1-[methyl-(2-methylidene-6-oxopiperidin-3-yl)amino]ethenyl]anilino]nonanoic acid.
| Compound Name | 9-[3-formyl-4-[1-[methyl-(2-methylidene-6-oxopiperidin-3-yl)amino]ethenyl]anilino]nonanoic acid |
|---|---|
| PubChem CID | 163374061 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 9-[3-formyl-4-[1-[methyl-(2-methylidene-6-oxopiperidin-3-yl)amino]ethenyl]anilino]nonanoic acid |
| SMILES | C=C1NC(=O)CCC1N(C)C(=C)c1ccc(NCCCCCCCCC(=O)O)cc1C=O |
| InChI | InChI=1S/C25H35N3O4/c1-18-23(13-14-24(30)27-18)28(3)19(2)22-12-11-21(16-20(22)17-29)26-15-9-7-5-4-6-8-10-25(31)32/h11-12,16-17,23,26H,1-2,4-10,13-15H2,3H3,(H,27,30)(H,31,32) |
| InChIKey | DMLUCFJVRWYTPN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|