C25H38N4O9 — CID 162486100
5-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]-N-(2,6-dioxopiperidin-3-yl)-2-formylbenzamide (PubChem CID 162486100) has the molecular formula C25H38N4O9 and a molecular weight of 538.60 g/mol. Its IUPAC name is 5-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]-N-(2,6-dioxopiperidin-3-yl)-2-formylbenzamide.
| Compound Name | 5-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]-N-(2,6-dioxopiperidin-3-yl)-2-formylbenzamide |
|---|---|
| PubChem CID | 162486100 |
| Molecular Formula | C25H38N4O9 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | 5-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]-N-(2,6-dioxopiperidin-3-yl)-2-formylbenzamide |
| SMILES | NCCOCCOCCOCCOCCOCCNc1ccc(C=O)c(C(=O)NC2CCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C25H38N4O9/c26-5-7-34-9-11-36-13-15-38-16-14-37-12-10-35-8-6-27-20-2-1-19(18-30)21(17-20)24(32)28-22-3-4-23(31)29-25(22)33/h1-2,17-18,22,27H,3-16,26H2,(H,28,32)(H,29,31,33) |
| InChIKey | FFIMHXASTNZSIJ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 176.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|