C22H35N5O5 — CID 177052191
3-[3-[2-[2-[2-[[(Z)-2-amino-3-(2-aminoethoxy)prop-1-enyl]amino]ethoxy]ethoxy]ethylamino]phenyl]piperidine-2,6-dione (PubChem CID 177052191) has the molecular formula C22H35N5O5 and a molecular weight of 449.55 g/mol. Its IUPAC name is 3-[3-[2-[2-[2-[[(Z)-2-amino-3-(2-aminoethoxy)prop-1-enyl]amino]ethoxy]ethoxy]ethylamino]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[3-[2-[2-[2-[[(Z)-2-amino-3-(2-aminoethoxy)prop-1-enyl]amino]ethoxy]ethoxy]ethylamino]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177052191 |
| Molecular Formula | C22H35N5O5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | 3-[3-[2-[2-[2-[[(Z)-2-amino-3-(2-aminoethoxy)prop-1-enyl]amino]ethoxy]ethoxy]ethylamino]phenyl]piperidine-2,6-dione |
| SMILES | NCCOC/C(N)=C/NCCOCCOCCNc1cccc(C2CCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C22H35N5O5/c23-6-9-32-16-18(24)15-25-7-10-30-12-13-31-11-8-26-19-3-1-2-17(14-19)20-4-5-21(28)27-22(20)29/h1-3,14-15,20,25-26H,4-13,16,23-24H2,(H,27,28,29)/b18-15- |
| InChIKey | PTRRIRSQBVLLLY-SDXDJHTJSA-N |
| XLogP | 0.02 |
| TPSA | 149.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|