C20H29N3O4 — CID 164540922
tert-butyl N-[4-[3-(2,6-dioxopiperidin-3-yl)anilino]butyl]carbamate (PubChem CID 164540922) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is tert-butyl N-[4-[3-(2,6-dioxopiperidin-3-yl)anilino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-(2,6-dioxopiperidin-3-yl)anilino]butyl]carbamate |
|---|---|
| PubChem CID | 164540922 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | tert-butyl N-[4-[3-(2,6-dioxopiperidin-3-yl)anilino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCNc1cccc(C2CCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C20H29N3O4/c1-20(2,3)27-19(26)22-12-5-4-11-21-15-8-6-7-14(13-15)16-9-10-17(24)23-18(16)25/h6-8,13,16,21H,4-5,9-12H2,1-3H3,(H,22,26)(H,23,24,25) |
| InChIKey | DHOHEQSAZTXFKR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|