C17H25N3O3 — CID 103821832
tert-butyl N-[3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]propyl]carbamate (PubChem CID 103821832) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is tert-butyl N-[3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 103821832 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | tert-butyl N-[3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C17H25N3O3/c1-17(2,3)23-16(22)19-10-4-9-18-13-6-7-14-12(11-13)5-8-15(21)20-14/h6-7,11,18H,4-5,8-10H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | AFGCARDYYHQYJI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|