C16H22ClN3O3 — CID 103821736
tert-butyl N-[3-[(6-chloro-2-oxo-1,3-dihydroindol-5-yl)amino]propyl]carbamate (PubChem CID 103821736) has the molecular formula C16H22ClN3O3 and a molecular weight of 339.82 g/mol. Its IUPAC name is tert-butyl N-[3-[(6-chloro-2-oxo-1,3-dihydroindol-5-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(6-chloro-2-oxo-1,3-dihydroindol-5-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 103821736 |
| Molecular Formula | C16H22ClN3O3 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | tert-butyl N-[3-[(6-chloro-2-oxo-1,3-dihydroindol-5-yl)amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1cc2c(cc1Cl)NC(=O)C2 |
| InChI | InChI=1S/C16H22ClN3O3/c1-16(2,3)23-15(22)19-6-4-5-18-13-7-10-8-14(21)20-12(10)9-11(13)17/h7,9,18H,4-6,8H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | OOVXKZPTRQNPLC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|