C13H15ClN2O2 — CID 106821342
6-chloro-5-[(3-methoxycyclobutyl)amino]-1,3-dihydroindol-2-one (PubChem CID 106821342) has the molecular formula C13H15ClN2O2 and a molecular weight of 266.73 g/mol. Its IUPAC name is 6-chloro-5-[(3-methoxycyclobutyl)amino]-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-[(3-methoxycyclobutyl)amino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 106821342 |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 6-chloro-5-[(3-methoxycyclobutyl)amino]-1,3-dihydroindol-2-one |
| SMILES | COC1CC(Nc2cc3c(cc2Cl)NC(=O)C3)C1 |
| InChI | InChI=1S/C13H15ClN2O2/c1-18-9-4-8(5-9)15-12-2-7-3-13(17)16-11(7)6-10(12)14/h2,6,8-9,15H,3-5H2,1H3,(H,16,17) |
| InChIKey | AYCFKSDXUKGNDX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |