C13H15ClN2O2S — CID 54981279
6-chloro-5-[(1-oxothian-4-yl)amino]-1,3-dihydroindol-2-one (PubChem CID 54981279) has the molecular formula C13H15ClN2O2S and a molecular weight of 298.80 g/mol. Its IUPAC name is 6-chloro-5-[(1-oxothian-4-yl)amino]-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-[(1-oxothian-4-yl)amino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 54981279 |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 6-chloro-5-[(1-oxothian-4-yl)amino]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(NC3CCS(=O)CC3)c(Cl)cc2N1 |
| InChI | InChI=1S/C13H15ClN2O2S/c14-10-7-11-8(6-13(17)16-11)5-12(10)15-9-1-3-19(18)4-2-9/h5,7,9,15H,1-4,6H2,(H,16,17) |
| InChIKey | SKJGMUATSBRIMW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |