C15H20ClN3O — CID 43691705
6-chloro-5-[(1-ethylpiperidin-4-yl)amino]-1,3-dihydroindol-2-one (PubChem CID 43691705) has the molecular formula C15H20ClN3O and a molecular weight of 293.80 g/mol. Its IUPAC name is 6-chloro-5-[(1-ethylpiperidin-4-yl)amino]-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-[(1-ethylpiperidin-4-yl)amino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43691705 |
| Molecular Formula | C15H20ClN3O |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 6-chloro-5-[(1-ethylpiperidin-4-yl)amino]-1,3-dihydroindol-2-one |
| SMILES | CCN1CCC(Nc2cc3c(cc2Cl)NC(=O)C3)CC1 |
| InChI | InChI=1S/C15H20ClN3O/c1-2-19-5-3-11(4-6-19)17-14-7-10-8-15(20)18-13(10)9-12(14)16/h7,9,11,17H,2-6,8H2,1H3,(H,18,20) |
| InChIKey | NRYHSJMAYCATON-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |