C11H13Cl2NO — CID 106821242
2,5-dichloro-N-(3-methoxycyclobutyl)aniline (PubChem CID 106821242) has the molecular formula C11H13Cl2NO and a molecular weight of 246.14 g/mol. Its IUPAC name is 2,5-dichloro-N-(3-methoxycyclobutyl)aniline.
| Compound Name | 2,5-dichloro-N-(3-methoxycyclobutyl)aniline |
|---|---|
| PubChem CID | 106821242 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2,5-dichloro-N-(3-methoxycyclobutyl)aniline |
| SMILES | COC1CC(Nc2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C11H13Cl2NO/c1-15-9-5-8(6-9)14-11-4-7(12)2-3-10(11)13/h2-4,8-9,14H,5-6H2,1H3 |
| InChIKey | FRLGYADVMWNSRK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |