C17H17Cl2N — CID 43632803
2,5-dichloro-N-[3-(4-methylphenyl)cyclobutyl]aniline (PubChem CID 43632803) has the molecular formula C17H17Cl2N and a molecular weight of 306.24 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-(4-methylphenyl)cyclobutyl]aniline.
| Compound Name | 2,5-dichloro-N-[3-(4-methylphenyl)cyclobutyl]aniline |
|---|---|
| PubChem CID | 43632803 |
| Molecular Formula | C17H17Cl2N |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2,5-dichloro-N-[3-(4-methylphenyl)cyclobutyl]aniline |
| SMILES | Cc1ccc(C2CC(Nc3cc(Cl)ccc3Cl)C2)cc1 |
| InChI | InChI=1S/C17H17Cl2N/c1-11-2-4-12(5-3-11)13-8-15(9-13)20-17-10-14(18)6-7-16(17)19/h2-7,10,13,15,20H,8-9H2,1H3 |
| InChIKey | PMCFSBTZLCDMPH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |