C11H13Cl2NS — CID 79942146
N-(2,5-dichlorophenyl)-5-methylthiolan-3-amine (PubChem CID 79942146) has the molecular formula C11H13Cl2NS and a molecular weight of 262.20 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-5-methylthiolan-3-amine.
| Compound Name | N-(2,5-dichlorophenyl)-5-methylthiolan-3-amine |
|---|---|
| PubChem CID | 79942146 |
| Molecular Formula | C11H13Cl2NS |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | N-(2,5-dichlorophenyl)-5-methylthiolan-3-amine |
| SMILES | CC1CC(Nc2cc(Cl)ccc2Cl)CS1 |
| InChI | InChI=1S/C11H13Cl2NS/c1-7-4-9(6-15-7)14-11-5-8(12)2-3-10(11)13/h2-3,5,7,9,14H,4,6H2,1H3 |
| InChIKey | FCCDRKNFMSEVLM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |