C11H12F3NS — CID 79941681
5-methyl-N-(2,3,4-trifluorophenyl)thiolan-3-amine (PubChem CID 79941681) has the molecular formula C11H12F3NS and a molecular weight of 247.28 g/mol. Its IUPAC name is 5-methyl-N-(2,3,4-trifluorophenyl)thiolan-3-amine.
| Compound Name | 5-methyl-N-(2,3,4-trifluorophenyl)thiolan-3-amine |
|---|---|
| PubChem CID | 79941681 |
| Molecular Formula | C11H12F3NS |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 5-methyl-N-(2,3,4-trifluorophenyl)thiolan-3-amine |
| SMILES | CC1CC(Nc2ccc(F)c(F)c2F)CS1 |
| InChI | InChI=1S/C11H12F3NS/c1-6-4-7(5-16-6)15-9-3-2-8(12)10(13)11(9)14/h2-3,6-7,15H,4-5H2,1H3 |
| InChIKey | COMBZUFJGRTVJF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|