C15H20F3N — CID 107447775
2,3,4-trifluoro-N-(3-propan-2-ylcyclohexyl)aniline (PubChem CID 107447775) has the molecular formula C15H20F3N and a molecular weight of 271.33 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-(3-propan-2-ylcyclohexyl)aniline.
| Compound Name | 2,3,4-trifluoro-N-(3-propan-2-ylcyclohexyl)aniline |
|---|---|
| PubChem CID | 107447775 |
| Molecular Formula | C15H20F3N |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 2,3,4-trifluoro-N-(3-propan-2-ylcyclohexyl)aniline |
| SMILES | CC(C)C1CCCC(Nc2ccc(F)c(F)c2F)C1 |
| InChI | InChI=1S/C15H20F3N/c1-9(2)10-4-3-5-11(8-10)19-13-7-6-12(16)14(17)15(13)18/h6-7,9-11,19H,3-5,8H2,1-2H3 |
| InChIKey | MWERAJWFDIXLML-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|