C13H16F3N — CID 113489683
N-(1-cyclobutylpropan-2-yl)-2,3,4-trifluoroaniline (PubChem CID 113489683) has the molecular formula C13H16F3N and a molecular weight of 243.27 g/mol. Its IUPAC name is N-(1-cyclobutylpropan-2-yl)-2,3,4-trifluoroaniline.
| Compound Name | N-(1-cyclobutylpropan-2-yl)-2,3,4-trifluoroaniline |
|---|---|
| PubChem CID | 113489683 |
| Molecular Formula | C13H16F3N |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | N-(1-cyclobutylpropan-2-yl)-2,3,4-trifluoroaniline |
| SMILES | CC(CC1CCC1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H16F3N/c1-8(7-9-3-2-4-9)17-11-6-5-10(14)12(15)13(11)16/h5-6,8-9,17H,2-4,7H2,1H3 |
| InChIKey | QFJOHYABDKATBX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|