C11H13ClN2O2S — CID 79942460
N-(4-chloro-3-nitrophenyl)-5-methylthiolan-3-amine (PubChem CID 79942460) has the molecular formula C11H13ClN2O2S and a molecular weight of 272.76 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-5-methylthiolan-3-amine.
| Compound Name | N-(4-chloro-3-nitrophenyl)-5-methylthiolan-3-amine |
|---|---|
| PubChem CID | 79942460 |
| Molecular Formula | C11H13ClN2O2S |
| Molecular Weight | 272.76 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-5-methylthiolan-3-amine |
| SMILES | CC1CC(Nc2ccc(Cl)c([N+](=O)[O-])c2)CS1 |
| InChI | InChI=1S/C11H13ClN2O2S/c1-7-4-9(6-17-7)13-8-2-3-10(12)11(5-8)14(15)16/h2-3,5,7,9,13H,4,6H2,1H3 |
| InChIKey | PLULOCCVOWQFIJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.76 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|