C13H14Cl2F3N — CID 64754843
2,5-dichloro-N-[4-(trifluoromethyl)cyclohexyl]aniline (PubChem CID 64754843) has the molecular formula C13H14Cl2F3N and a molecular weight of 312.16 g/mol. Its IUPAC name is 2,5-dichloro-N-[4-(trifluoromethyl)cyclohexyl]aniline.
| Compound Name | 2,5-dichloro-N-[4-(trifluoromethyl)cyclohexyl]aniline |
|---|---|
| PubChem CID | 64754843 |
| Molecular Formula | C13H14Cl2F3N |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 2,5-dichloro-N-[4-(trifluoromethyl)cyclohexyl]aniline |
| SMILES | FC(F)(F)C1CCC(Nc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C13H14Cl2F3N/c14-9-3-6-11(15)12(7-9)19-10-4-1-8(2-5-10)13(16,17)18/h3,6-8,10,19H,1-2,4-5H2 |
| InChIKey | WMISTHUDYOUJPK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |