C15H19ClF3N — CID 43730387
N-[1-(4-chlorophenyl)ethyl]-4-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 43730387) has the molecular formula C15H19ClF3N and a molecular weight of 305.77 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethyl]-4-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N-[1-(4-chlorophenyl)ethyl]-4-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 43730387 |
| Molecular Formula | C15H19ClF3N |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethyl]-4-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | CC(NC1CCC(C(F)(F)F)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H19ClF3N/c1-10(11-2-6-13(16)7-3-11)20-14-8-4-12(5-9-14)15(17,18)19/h2-3,6-7,10,12,14,20H,4-5,8-9H2,1H3 |
| InChIKey | POXALDGMCFGEHO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |