C15H20F3N — CID 81350691
N-[(1S)-1-phenylethyl]-4-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 81350691) has the molecular formula C15H20F3N and a molecular weight of 271.33 g/mol. Its IUPAC name is N-[(1S)-1-phenylethyl]-4-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N-[(1S)-1-phenylethyl]-4-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 81350691 |
| Molecular Formula | C15H20F3N |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | N-[(1S)-1-phenylethyl]-4-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | C[C@H](NC1CCC(C(F)(F)F)CC1)c1ccccc1 |
| InChI | InChI=1S/C15H20F3N/c1-11(12-5-3-2-4-6-12)19-14-9-7-13(8-10-14)15(16,17)18/h2-6,11,13-14,19H,7-10H2,1H3/t11-,13?,14?/m0/s1 |
| InChIKey | KPTURIFZWLBICM-XGNXJENSSA-N |
| XLogP | 4.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |