C16H17Cl2N3 — CID 43166964
N-(2,5-dichlorophenyl)-1-pyridin-4-ylpiperidin-4-amine (PubChem CID 43166964) has the molecular formula C16H17Cl2N3 and a molecular weight of 322.24 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-1-pyridin-4-ylpiperidin-4-amine.
| Compound Name | N-(2,5-dichlorophenyl)-1-pyridin-4-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 43166964 |
| Molecular Formula | C16H17Cl2N3 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-(2,5-dichlorophenyl)-1-pyridin-4-ylpiperidin-4-amine |
| SMILES | Clc1ccc(Cl)c(NC2CCN(c3ccncc3)CC2)c1 |
| InChI | InChI=1S/C16H17Cl2N3/c17-12-1-2-15(18)16(11-12)20-13-5-9-21(10-6-13)14-3-7-19-8-4-14/h1-4,7-8,11,13,20H,5-6,9-10H2 |
| InChIKey | DNROIYCWGIEJSJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |