C15H24ClN3O4S — CID 113269164
tert-butyl N-[3-[3-chloro-4-(methanesulfonamido)anilino]propyl]carbamate (PubChem CID 113269164) has the molecular formula C15H24ClN3O4S and a molecular weight of 377.89 g/mol. Its IUPAC name is tert-butyl N-[3-[3-chloro-4-(methanesulfonamido)anilino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-chloro-4-(methanesulfonamido)anilino]propyl]carbamate |
|---|---|
| PubChem CID | 113269164 |
| Molecular Formula | C15H24ClN3O4S |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | tert-butyl N-[3-[3-chloro-4-(methanesulfonamido)anilino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1ccc(NS(C)(=O)=O)c(Cl)c1 |
| InChI | InChI=1S/C15H24ClN3O4S/c1-15(2,3)23-14(20)18-9-5-8-17-11-6-7-13(12(16)10-11)19-24(4,21)22/h6-7,10,17,19H,5,8-9H2,1-4H3,(H,18,20) |
| InChIKey | PGPNGAANMOKPQD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|