C14H24N4O4S — CID 103821849
tert-butyl N-[3-[3-(sulfamoylamino)anilino]propyl]carbamate (PubChem CID 103821849) has the molecular formula C14H24N4O4S and a molecular weight of 344.44 g/mol. Its IUPAC name is tert-butyl N-[3-[3-(sulfamoylamino)anilino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-(sulfamoylamino)anilino]propyl]carbamate |
|---|---|
| PubChem CID | 103821849 |
| Molecular Formula | C14H24N4O4S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | tert-butyl N-[3-[3-(sulfamoylamino)anilino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1cccc(NS(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H24N4O4S/c1-14(2,3)22-13(19)17-9-5-8-16-11-6-4-7-12(10-11)18-23(15,20)21/h4,6-7,10,16,18H,5,8-9H2,1-3H3,(H,17,19)(H2,15,20,21) |
| InChIKey | OZBKZULLJBVZCC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|