C25H33N3O4 — CID 176814239
methyl (2S)-2-(1,3-dihydroisoindol-2-yl)-2-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]phenyl]acetate (PubChem CID 176814239) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is methyl (2S)-2-(1,3-dihydroisoindol-2-yl)-2-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]phenyl]acetate.
| Compound Name | methyl (2S)-2-(1,3-dihydroisoindol-2-yl)-2-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]phenyl]acetate |
|---|---|
| PubChem CID | 176814239 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | methyl (2S)-2-(1,3-dihydroisoindol-2-yl)-2-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]phenyl]acetate |
| SMILES | COC(=O)[C@H](c1cccc(NCCCNC(=O)OC(C)(C)C)c1)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C25H33N3O4/c1-25(2,3)32-24(30)27-14-8-13-26-21-12-7-11-18(15-21)22(23(29)31-4)28-16-19-9-5-6-10-20(19)17-28/h5-7,9-12,15,22,26H,8,13-14,16-17H2,1-4H3,(H,27,30)/t22-/m0/s1 |
| InChIKey | GGLBQPFUNAFTPZ-QFIPXVFZSA-N |
| XLogP | 4.24 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|