C27H35F2N3O5 — CID 155933892
methyl (2S)-2-[(3-anilino-2,2-difluoro-3-phenylpropanoyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 155933892) has the molecular formula C27H35F2N3O5 and a molecular weight of 519.59 g/mol. Its IUPAC name is methyl (2S)-2-[(3-anilino-2,2-difluoro-3-phenylpropanoyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | methyl (2S)-2-[(3-anilino-2,2-difluoro-3-phenylpropanoyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 155933892 |
| Molecular Formula | C27H35F2N3O5 |
| Molecular Weight | 519.59 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | methyl (2S)-2-[(3-anilino-2,2-difluoro-3-phenylpropanoyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)C(F)(F)C(Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H35F2N3O5/c1-26(2,3)37-25(35)30-18-12-11-17-21(23(33)36-4)32-24(34)27(28,29)22(19-13-7-5-8-14-19)31-20-15-9-6-10-16-20/h5-10,13-16,21-22,31H,11-12,17-18H2,1-4H3,(H,30,35)(H,32,34)/t21-,22?/m0/s1 |
| InChIKey | AIPKIQHLPGMICV-HMTLIYDFSA-N |
| XLogP | 4.83 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|