C26H31N3O6 — CID 171640006
(2,5-dioxopyrrolidin-1-yl) 2-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]phenyl]-2-phenylacetate (PubChem CID 171640006) has the molecular formula C26H31N3O6 and a molecular weight of 481.55 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]phenyl]-2-phenylacetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]phenyl]-2-phenylacetate |
|---|---|
| PubChem CID | 171640006 |
| Molecular Formula | C26H31N3O6 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]phenyl]-2-phenylacetate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1cccc(C(C(=O)ON2C(=O)CCC2=O)c2ccccc2)c1 |
| InChI | InChI=1S/C26H31N3O6/c1-26(2,3)34-25(33)28-16-8-15-27-20-12-7-11-19(17-20)23(18-9-5-4-6-10-18)24(32)35-29-21(30)13-14-22(29)31/h4-7,9-12,17,23,27H,8,13-16H2,1-3H3,(H,28,33) |
| InChIKey | QAMFBXUFQMXHQZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|