C44H57ClN4O6 — CID 159376619
tert-butyl N-(3-aminopropyl)carbamate;tert-butyl N-[3-[(2,2-diphenylacetyl)amino]propyl]carbamate;2,2-diphenylacetyl chloride (PubChem CID 159376619) has the molecular formula C44H57ClN4O6 and a molecular weight of 773.42 g/mol. Its IUPAC name is tert-butyl N-(3-aminopropyl)carbamate;tert-butyl N-[3-[(2,2-diphenylacetyl)amino]propyl]carbamate;2,2-diphenylacetyl chloride.
| Compound Name | tert-butyl N-(3-aminopropyl)carbamate;tert-butyl N-[3-[(2,2-diphenylacetyl)amino]propyl]carbamate;2,2-diphenylacetyl chloride |
|---|---|
| PubChem CID | 159376619 |
| Molecular Formula | C44H57ClN4O6 |
| Molecular Weight | 773.42 g/mol |
| Exact Mass | 772.40 |
| IUPAC Name | tert-butyl N-(3-aminopropyl)carbamate;tert-butyl N-[3-[(2,2-diphenylacetyl)amino]propyl]carbamate;2,2-diphenylacetyl chloride |
| SMILES | CC(C)(C)OC(=O)NCCCN.CC(C)(C)OC(=O)NCCCNC(=O)C(c1ccccc1)c1ccccc1.O=C(Cl)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28N2O3.C14H11ClO.C8H18N2O2/c1-22(2,3)27-21(26)24-16-10-15-23-20(25)19(17-11-6-4-7-12-17)18-13-8-5-9-14-18;15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-8(2,3)12-7(11)10-6-4-5-9/h4-9,11-14,19H,10,15-16H2,1-3H3,(H,23,25)(H,24,26);1-10,13H;4-6,9H2,1-3H3,(H,10,11) |
| InChIKey | LKJWLCUCLUIYSD-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.42 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|