C17H25N5O2 — CID 113269167
tert-butyl N-[3-[3-(1,2,4-triazol-1-ylmethyl)anilino]propyl]carbamate (PubChem CID 113269167) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is tert-butyl N-[3-[3-(1,2,4-triazol-1-ylmethyl)anilino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-(1,2,4-triazol-1-ylmethyl)anilino]propyl]carbamate |
|---|---|
| PubChem CID | 113269167 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | tert-butyl N-[3-[3-(1,2,4-triazol-1-ylmethyl)anilino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1cccc(Cn2cncn2)c1 |
| InChI | InChI=1S/C17H25N5O2/c1-17(2,3)24-16(23)20-9-5-8-19-15-7-4-6-14(10-15)11-22-13-18-12-21-22/h4,6-7,10,12-13,19H,5,8-9,11H2,1-3H3,(H,20,23) |
| InChIKey | ICHXNZGZBXFGJQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|