C13H16N4 — CID 54866198
N-(cyclopropylmethyl)-3-(1,2,4-triazol-1-ylmethyl)aniline (PubChem CID 54866198) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-3-(1,2,4-triazol-1-ylmethyl)aniline.
| Compound Name | N-(cyclopropylmethyl)-3-(1,2,4-triazol-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 54866198 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | N-(cyclopropylmethyl)-3-(1,2,4-triazol-1-ylmethyl)aniline |
| SMILES | c1cc(Cn2cncn2)cc(NCC2CC2)c1 |
| InChI | InChI=1S/C13H16N4/c1-2-12(8-17-10-14-9-16-17)6-13(3-1)15-7-11-4-5-11/h1-3,6,9-11,15H,4-5,7-8H2 |
| InChIKey | KDDSELZKHOIXNO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |