C15H20N4O — CID 65081861
N-[3-(1,2,4-triazol-1-ylmethyl)phenyl]oxepan-4-amine (PubChem CID 65081861) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is N-[3-(1,2,4-triazol-1-ylmethyl)phenyl]oxepan-4-amine.
| Compound Name | N-[3-(1,2,4-triazol-1-ylmethyl)phenyl]oxepan-4-amine |
|---|---|
| PubChem CID | 65081861 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | N-[3-(1,2,4-triazol-1-ylmethyl)phenyl]oxepan-4-amine |
| SMILES | c1cc(Cn2cncn2)cc(NC2CCCOCC2)c1 |
| InChI | InChI=1S/C15H20N4O/c1-3-13(10-19-12-16-11-17-19)9-15(4-1)18-14-5-2-7-20-8-6-14/h1,3-4,9,11-12,14,18H,2,5-8,10H2 |
| InChIKey | KRYPEVHQJDDWFO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |