C16H23N5O2 — CID 103818434
tert-butyl N-[2-[4-(1,2,4-triazol-1-ylmethyl)anilino]ethyl]carbamate (PubChem CID 103818434) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(1,2,4-triazol-1-ylmethyl)anilino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(1,2,4-triazol-1-ylmethyl)anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 103818434 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | tert-butyl N-[2-[4-(1,2,4-triazol-1-ylmethyl)anilino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1ccc(Cn2cncn2)cc1 |
| InChI | InChI=1S/C16H23N5O2/c1-16(2,3)23-15(22)19-9-8-18-14-6-4-13(5-7-14)10-21-12-17-11-20-21/h4-7,11-12,18H,8-10H2,1-3H3,(H,19,22) |
| InChIKey | UQAHDDZWLCEZCT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|