C18H25N5O3 — CID 78860163
tert-butyl N-[4-oxo-4-[4-(1,2,4-triazol-1-ylmethyl)anilino]butyl]carbamate (PubChem CID 78860163) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is tert-butyl N-[4-oxo-4-[4-(1,2,4-triazol-1-ylmethyl)anilino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-oxo-4-[4-(1,2,4-triazol-1-ylmethyl)anilino]butyl]carbamate |
|---|---|
| PubChem CID | 78860163 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | tert-butyl N-[4-oxo-4-[4-(1,2,4-triazol-1-ylmethyl)anilino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)Nc1ccc(Cn2cncn2)cc1 |
| InChI | InChI=1S/C18H25N5O3/c1-18(2,3)26-17(25)20-10-4-5-16(24)22-15-8-6-14(7-9-15)11-23-13-19-12-21-23/h6-9,12-13H,4-5,10-11H2,1-3H3,(H,20,25)(H,22,24) |
| InChIKey | BNASRXMLRNLNMO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|