C17H22N6O5 — CID 155384533
2-[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]phenyl]tetrazole-5-carboxylic acid (PubChem CID 155384533) has the molecular formula C17H22N6O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is 2-[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]phenyl]tetrazole-5-carboxylic acid.
| Compound Name | 2-[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]phenyl]tetrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 155384533 |
| Molecular Formula | C17H22N6O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoylamino]phenyl]tetrazole-5-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)Nc1ccc(-n2nnc(C(=O)O)n2)cc1 |
| InChI | InChI=1S/C17H22N6O5/c1-17(2,3)28-16(27)18-10-4-5-13(24)19-11-6-8-12(9-7-11)23-21-14(15(25)26)20-22-23/h6-9H,4-5,10H2,1-3H3,(H,18,27)(H,19,24)(H,25,26) |
| InChIKey | OYRHRRRNOLWPCF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 148.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|