C13H21ClN2O3S — CID 106675322
N-[2-chloro-4-[(3-methoxy-3-methylbutyl)amino]phenyl]methanesulfonamide (PubChem CID 106675322) has the molecular formula C13H21ClN2O3S and a molecular weight of 320.84 g/mol. Its IUPAC name is N-[2-chloro-4-[(3-methoxy-3-methylbutyl)amino]phenyl]methanesulfonamide.
| Compound Name | N-[2-chloro-4-[(3-methoxy-3-methylbutyl)amino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 106675322 |
| Molecular Formula | C13H21ClN2O3S |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-[2-chloro-4-[(3-methoxy-3-methylbutyl)amino]phenyl]methanesulfonamide |
| SMILES | COC(C)(C)CCNc1ccc(NS(C)(=O)=O)c(Cl)c1 |
| InChI | InChI=1S/C13H21ClN2O3S/c1-13(2,19-3)7-8-15-10-5-6-12(11(14)9-10)16-20(4,17)18/h5-6,9,15-16H,7-8H2,1-4H3 |
| InChIKey | IOCWHQRAIDQDBS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |