C14H17ClN2O3S — CID 62346171
N-[2-chloro-4-[(5-ethylfuran-2-yl)methylamino]phenyl]methanesulfonamide (PubChem CID 62346171) has the molecular formula C14H17ClN2O3S and a molecular weight of 328.82 g/mol. Its IUPAC name is N-[2-chloro-4-[(5-ethylfuran-2-yl)methylamino]phenyl]methanesulfonamide.
| Compound Name | N-[2-chloro-4-[(5-ethylfuran-2-yl)methylamino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 62346171 |
| Molecular Formula | C14H17ClN2O3S |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | N-[2-chloro-4-[(5-ethylfuran-2-yl)methylamino]phenyl]methanesulfonamide |
| SMILES | CCc1ccc(CNc2ccc(NS(C)(=O)=O)c(Cl)c2)o1 |
| InChI | InChI=1S/C14H17ClN2O3S/c1-3-11-5-6-12(20-11)9-16-10-4-7-14(13(15)8-10)17-21(2,18)19/h4-8,16-17H,3,9H2,1-2H3 |
| InChIKey | ZPPUCBSYWYIHPU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |