C13H15N3O — CID 115231431
4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]butanenitrile (PubChem CID 115231431) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]butanenitrile.
| Compound Name | 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]butanenitrile |
|---|---|
| PubChem CID | 115231431 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]butanenitrile |
| SMILES | N#CCCCNc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C13H15N3O/c14-7-1-2-8-15-11-4-5-12-10(9-11)3-6-13(17)16-12/h4-5,9,15H,1-3,6,8H2,(H,16,17) |
| InChIKey | OOKHSABCLHYYIH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|