C14H20N2O — CID 43737958
6-(3-methylbutylamino)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 43737958) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 6-(3-methylbutylamino)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(3-methylbutylamino)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 43737958 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 6-(3-methylbutylamino)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CC(C)CCNc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C14H20N2O/c1-10(2)7-8-15-12-4-5-13-11(9-12)3-6-14(17)16-13/h4-5,9-10,15H,3,6-8H2,1-2H3,(H,16,17) |
| InChIKey | UNYCJWXZAYMSAC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |