C12H18N4O — CID 115119383
6-(2,3-diaminopropylamino)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 115119383) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 6-(2,3-diaminopropylamino)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(2,3-diaminopropylamino)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 115119383 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 6-(2,3-diaminopropylamino)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | NCC(N)CNc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C12H18N4O/c13-6-9(14)7-15-10-2-3-11-8(5-10)1-4-12(17)16-11/h2-3,5,9,15H,1,4,6-7,13-14H2,(H,16,17) |
| InChIKey | CVGJHXJFVRCZTR-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |