C14H19N3O2 — CID 80542372
4-amino-2-methyl-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)butanamide (PubChem CID 80542372) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-amino-2-methyl-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)butanamide.
| Compound Name | 4-amino-2-methyl-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)butanamide |
|---|---|
| PubChem CID | 80542372 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-amino-2-methyl-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)butanamide |
| SMILES | CC(CCN)C(=O)Nc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C14H19N3O2/c1-9(6-7-15)14(19)16-11-3-4-12-10(8-11)2-5-13(18)17-12/h3-4,8-9H,2,5-7,15H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | VKZAGFXXAKLISJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |