C13H17N3O2 — CID 60837196
3-amino-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)butanamide (PubChem CID 60837196) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 3-amino-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)butanamide.
| Compound Name | 3-amino-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)butanamide |
|---|---|
| PubChem CID | 60837196 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 3-amino-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)butanamide |
| SMILES | CC(N)CC(=O)Nc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C13H17N3O2/c1-8(14)6-13(18)15-10-3-4-11-9(7-10)2-5-12(17)16-11/h3-4,7-8H,2,5-6,14H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | PKKLXFSNFDMUAV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |