C21H31N3O4 — CID 164540949
tert-butyl N-[5-[3-(2,6-dioxopiperidin-3-yl)anilino]pentyl]carbamate (PubChem CID 164540949) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is tert-butyl N-[5-[3-(2,6-dioxopiperidin-3-yl)anilino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[3-(2,6-dioxopiperidin-3-yl)anilino]pentyl]carbamate |
|---|---|
| PubChem CID | 164540949 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | tert-butyl N-[5-[3-(2,6-dioxopiperidin-3-yl)anilino]pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCNc1cccc(C2CCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C21H31N3O4/c1-21(2,3)28-20(27)23-13-6-4-5-12-22-16-9-7-8-15(14-16)17-10-11-18(25)24-19(17)26/h7-9,14,17,22H,4-6,10-13H2,1-3H3,(H,23,27)(H,24,25,26) |
| InChIKey | VQLPVPCZZSBXJS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|